Inquiry email: info@leader-biogroup.com
Hot Line +86-029-68895030
+86-029-68569961
+86-029-68569962
Fax +86-029-68895030
product Name |
Methyl myristate |
Synonyms |
Methyl tetradecanoate; methyl myristate 99%; Myristic Acid Methyl Ester; Tetradecanoic acid methyl ester |
Molecular Formula |
C15H30O2 |
Molecular Weight |
242.40 |
InChI |
InChI=1/C15H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17-2/h3-14H2,1-2H3 |
CAS Registry Number |
124-10-7 |
EINECS |
204-680-1 |
Molecular Structure |
|
Density |
0.863 |
Melting point |
18.4-20℃ |
Boiling point |
323℃ |
Refractive index |
1.434-1.438 |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.; |